3-chloro-8-phenyl-8-sulfanylidene-7,9-diaza-8$l^C12H10ClN2PS-phosphabicyclo[4.3.0]nona-2,4,10-triene structure
|
Common Name | 3-chloro-8-phenyl-8-sulfanylidene-7,9-diaza-8$l^C12H10ClN2PS-phosphabicyclo[4.3.0]nona-2,4,10-triene | ||
|---|---|---|---|---|
| CAS Number | 4600-17-3 | Molecular Weight | 280.71300 | |
| Density | 1.46g/cm3 | Boiling Point | 418.1ºC at 760 mmHg | |
| Molecular Formula | C12H10ClN2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.6ºC | |
| Name | 5-chloro-2-phenyl-2-sulfanylidene-1,3-dihydro-1,3,2λ5-benzodiazaphosphole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 418.1ºC at 760 mmHg |
| Molecular Formula | C12H10ClN2PS |
| Molecular Weight | 280.71300 |
| Flash Point | 206.6ºC |
| Exact Mass | 279.99900 |
| PSA | 65.96000 |
| LogP | 4.73900 |
| Index of Refraction | 1.714 |
| InChIKey | BZBDLTMAECHPOY-UHFFFAOYSA-N |
| SMILES | S=P1(c2ccccc2)Nc2ccc(Cl)cc2N1 |
|
~%
3-chloro-8-phen... CAS#:4600-17-3 |
| Literature: Dannley,R.L.; Grava,A. Canadian Journal of Chemistry, 1965 , vol. 43, p. 3377 - 3386 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-chloro-2-phenyl-2,3-dihydro-1H-benzo[1,3,2]diazaphosphole 2-sulfide |
| 5-Chloro-2-phenyl-2,3-dihydro-1H-1,3,2-benzodiazaphosphole 2-sulfide |
| 5-Chlor-2-phenyl-2,3-dihydro-1H-1,3,2-benzodiazaphosphol-2-sulfid |