5-chloro-7-methoxy-1-benzofuran-2-carboxylic acid
Modify Date: 2025-08-29 19:22:14
5-chloro-7-methoxy-1-benzofuran-2-carboxylic acid structure
|
Common Name | 5-chloro-7-methoxy-1-benzofuran-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 460044-74-0 | Molecular Weight | 226.61300 | |
| Density | 1.463g/cm3 | Boiling Point | 385.5ºC at 760 mmHg | |
| Molecular Formula | C10H7ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187ºC | |
| Name | 5-chloro-7-methoxy-1-benzofuran-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.463g/cm3 |
|---|---|
| Boiling Point | 385.5ºC at 760 mmHg |
| Molecular Formula | C10H7ClO4 |
| Molecular Weight | 226.61300 |
| Flash Point | 187ºC |
| Exact Mass | 226.00300 |
| PSA | 59.67000 |
| LogP | 2.79300 |
| Index of Refraction | 1.627 |
| InChIKey | SJIWXWCGQMFLNE-UHFFFAOYSA-N |
| SMILES | COc1cc(Cl)cc2cc(C(=O)O)oc12 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Chloro-7-methoxy-benzofuran-2-carboxylic acid |