5-Bromo-7-methoxy-1-benzofuran-2-carboxylic acid structure
|
Common Name | 5-Bromo-7-methoxy-1-benzofuran-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 20037-37-0 | Molecular Weight | 271.06400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7BrO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-Bromo-7-methoxy-1-benzofuran-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H7BrO4 |
|---|---|
| Molecular Weight | 271.06400 |
| Exact Mass | 269.95300 |
| PSA | 59.67000 |
| LogP | 2.90210 |
| InChIKey | OEICZFFUNDGUEF-UHFFFAOYSA-N |
| SMILES | COc1cc(Br)cc2cc(C(=O)O)oc12 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2932999099 |
|
~%
5-Bromo-7-metho... CAS#:20037-37-0 |
| Literature: F. HOFFMANN-LA ROCHE AG Patent: WO2004/41275 A1, 2004 ; Location in patent: Page/Page column 27 ; WO 2004/041275 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-broMo-7-Methoxy-1-benzofuran-2-carboxylic acid |