2-[2-(5-nitrothiophen-2-yl)ethenyl]pyridine structure
|
Common Name | 2-[2-(5-nitrothiophen-2-yl)ethenyl]pyridine | ||
|---|---|---|---|---|
| CAS Number | 4601-06-3 | Molecular Weight | 232.25800 | |
| Density | 1.389g/cm3 | Boiling Point | 388ºC at 760 mmHg | |
| Molecular Formula | C11H8N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.5ºC | |
| Name | (E)-2-(2-(5-nitrothiophen-2-yl)vinyl)pyridine |
|---|
| Density | 1.389g/cm3 |
|---|---|
| Boiling Point | 388ºC at 760 mmHg |
| Molecular Formula | C11H8N2O2S |
| Molecular Weight | 232.25800 |
| Flash Point | 188.5ºC |
| Exact Mass | 232.03100 |
| PSA | 86.95000 |
| LogP | 3.74490 |
| Index of Refraction | 1.729 |
| InChIKey | UPYSFQIPVHHZBB-SNAWJCMRSA-N |
| SMILES | O=[N+]([O-])c1ccc(C=Cc2ccccn2)s1 |
| HS Code | 2934999090 |
|---|
|
~%
2-[2-(5-nitroth... CAS#:4601-06-3 |
| Literature: Henry; Brown; Cory; et al. Journal of Medicinal Chemistry, 1973 , vol. 16, # 11 p. 1287 - 1291 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |