1,1,2-trichloro-2-nitroethene structure
|
Common Name | 1,1,2-trichloro-2-nitroethene | ||
|---|---|---|---|---|
| CAS Number | 4607-81-2 | Molecular Weight | 176.38600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C2Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,2-trichloro-2-nitroethene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C2Cl3NO2 |
|---|---|
| Molecular Weight | 176.38600 |
| Exact Mass | 174.89900 |
| PSA | 45.82000 |
| LogP | 2.62930 |
| InChIKey | BKOLIJBSENFKNE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])C(Cl)=C(Cl)Cl |
| HS Code | 2904909090 |
|---|
|
~32%
1,1,2-trichloro... CAS#:4607-81-2 |
| Literature: Maichrowski, Jan; Gjikaj, Mimoza; Huebner, Eike G.; Bergmann, Baerbel; Mueller, Ingrid B.; Kaufmann, Dieter E. European Journal of Organic Chemistry, 2013 , # 11 p. 2091 - 2105 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,2,2-Trichlor-1-nitro-aethylen |
| 1,2,2-trichloronitroethylene |
| Ethene,trichloronitro |
| 1,1,2-trichloro-2-nitroethylene |
| trichloronitroethylene |
| trichloro-nitro-ethene |