5-O-Benzoyl-1,2-di-O-acetyl-3-deoxy-D-ribofuranose structure
|
Common Name | 5-O-Benzoyl-1,2-di-O-acetyl-3-deoxy-D-ribofuranose | ||
|---|---|---|---|---|
| CAS Number | 4613-71-2 | Molecular Weight | 322.31000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(2S,4R)-4,5-diacetyloxyoxolan-2-yl]methyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H18O7 |
|---|---|
| Molecular Weight | 322.31000 |
| Exact Mass | 322.10500 |
| PSA | 88.13000 |
| LogP | 1.45320 |
| Index of Refraction | 1.531 |
| InChIKey | DPLPHOLDKAGPOZ-NNKZFNQJSA-N |
| SMILES | CC(=O)OC1CC(COC(=O)c2ccccc2)OC1OC(C)=O |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1,2-di-O-acetyl-5-O-benzoyl-3-deoxy-D-erythropentose |
| 1,2-O-Diacetyl-5-O-benzoyl-3-deoxyribose |
| 1,2-Di-O-acetyl-5-O-benzoyl-3-deoxy-D-ribofuranose |
| [(2S,4R)-4,5-bis(acetyloxy)tetrahydro-2-furanyl] methyl benzoate |
| D-erythro-Pentofuranose,3-deoxy-,1,2-diacetate 5-benzoate |
| 1,2-di-O-acetyl-5-benzoyl-3-deoxy-D-xylose |