tert-butyl N-naphthalen-2-ylsulfonylcarbamate structure
|
Common Name | tert-butyl N-naphthalen-2-ylsulfonylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 461441-06-5 | Molecular Weight | 307.36500 | |
| Density | 1.261g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H17NO4S | Melting Point | 164-168ºC (dec.)(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl N-naphthalen-2-ylsulfonylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261g/cm3 |
|---|---|
| Melting Point | 164-168ºC (dec.)(lit.) |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.36500 |
| Exact Mass | 307.08800 |
| PSA | 80.85000 |
| LogP | 4.52490 |
| Index of Refraction | 1.586 |
| InChIKey | YNCXVASJISKFKT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)c1ccc2ccccc2c1 |
|
~95%
tert-butyl N-na... CAS#:461441-06-5 |
| Literature: Grehn, Leif; Ragnarsson, Ulf Journal of Organic Chemistry, 2002 , vol. 67, # 18 p. 6557 - 6559 |
|
~%
tert-butyl N-na... CAS#:461441-06-5 |
| Literature: Grehn, Leif; Ragnarsson, Ulf Journal of Organic Chemistry, 2002 , vol. 67, # 18 p. 6557 - 6559 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| tert-butyl 2-naphthalenesulfonylcarbamate |
| N-Boc-2-naphthalenesulfonamide |
| N-tert-Butyl-2-naphthalenesulfonylcarbamate |