dihexyl benzene-1,3-dicarboxylate structure
|
Common Name | dihexyl benzene-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 4623-71-6 | Molecular Weight | 334.45000 | |
| Density | 1.012g/cm3 | Boiling Point | 383ºC at 760 mmHg | |
| Molecular Formula | C20H30O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.4ºC | |
| Name | dihexyl benzene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.012g/cm3 |
|---|---|
| Boiling Point | 383ºC at 760 mmHg |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.45000 |
| Flash Point | 203.4ºC |
| Exact Mass | 334.21400 |
| PSA | 52.60000 |
| LogP | 5.16080 |
| Index of Refraction | 1.493 |
| InChIKey | FGWAPOKSKMNBEN-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)c1cccc(C(=O)OCCCCCC)c1 |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,3-Benzenedicarboxylic acid,dihexyl ester |
| Isophthalsaeure-dihexylester |