N-butyl-N,N,2-triethyl-hexanimidamide structure
|
Common Name | N-butyl-N,N,2-triethyl-hexanimidamide | ||
|---|---|---|---|---|
| CAS Number | 4626-34-0 | Molecular Weight | 254.45500 | |
| Density | 0.84g/cm3 | Boiling Point | 347.7ºC at 760 mmHg | |
| Molecular Formula | C16H34N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.1ºC | |
| Name | 2-(2-Metossi-4-allil-6-dimetilamminometil-fenossi)-N,N-dietil-acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.84g/cm3 |
|---|---|
| Boiling Point | 347.7ºC at 760 mmHg |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.45500 |
| Flash Point | 164.1ºC |
| Exact Mass | 254.27200 |
| PSA | 15.60000 |
| LogP | 4.74320 |
| Index of Refraction | 1.458 |
| InChIKey | FOJBWAOETLRVQM-UHFFFAOYSA-N |
| SMILES | CCCCN=C(C(CC)CCCC)N(CC)CC |
| HS Code | 2925290090 |
|---|
|
~%
N-butyl-N,N,2-t... CAS#:4626-34-0 |
| Literature: Stevens,C.L. et al. Journal of Organic Chemistry, 1965 , vol. 30, p. 3718 - 3720 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N,N-Diaethyl-2-(2-methoxy-4-allyl-6-dimethylaminomethyl-phenoxy)-acetamid |
| 2-(2-Metossi-4-allil-6-dimetilamminometil-fenossi)-N,N-dietil-acetamide [Italian] |
| N,N-Diaethyl-2-aethyl-N'-butyl-caproamidin |
| Acetamide,2-((4-allyl-2-(dimethylamino)-6-methoxy-o-tolyl)oxy)-N,N-diethyl |
| 2-((4-Allyl-2-(dimethylamino)-6-methoxy-o-tolyl)oxy)-N,N-diethyl-acetamide |
| 2-[2-(dimethylaminomethyl)-6-methoxy-4-prop-2-enylphenoxy]-N,N-diethylacetamide |