N-butyl-N,N-dimethyl-5H-purine-2,6-diamine structure
|
Common Name | N-butyl-N,N-dimethyl-5H-purine-2,6-diamine | ||
|---|---|---|---|---|
| CAS Number | 5451-42-3 | Molecular Weight | 234.30100 | |
| Density | 1.27g/cm3 | Boiling Point | 334ºC at 760 mmHg | |
| Molecular Formula | C11H18N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.8ºC | |
| Name | N6-butyl-N2,N2-dimethyl-7H-purine-2,6-diamine |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 334ºC at 760 mmHg |
| Molecular Formula | C11H18N6 |
| Molecular Weight | 234.30100 |
| Flash Point | 155.8ºC |
| Exact Mass | 234.15900 |
| PSA | 69.73000 |
| LogP | 1.70390 |
| Index of Refraction | 1.644 |
| InChIKey | FDDWTWCVBNWYIA-UHFFFAOYSA-N |
| SMILES | CCCCNc1nc(N(C)C)nc2nc[nH]c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |