4,4'-Di-tert-butyldiphenylamine structure
|
Common Name | 4,4'-Di-tert-butyldiphenylamine | ||
|---|---|---|---|---|
| CAS Number | 4627-22-9 | Molecular Weight | 281.43500 | |
| Density | 0.974g/cm3 | Boiling Point | 195ºC / 3mmHg | |
| Molecular Formula | C20H27N | Melting Point | 185-186 ºC | |
| MSDS | N/A | Flash Point | 188.1ºC | |
| Name | Bis(4-tert-butylphenyl)amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.974g/cm3 |
|---|---|
| Boiling Point | 195ºC / 3mmHg |
| Melting Point | 185-186 ºC |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.43500 |
| Flash Point | 188.1ºC |
| Exact Mass | 281.21400 |
| PSA | 12.03000 |
| LogP | 6.09820 |
| Index of Refraction | 1.552 |
| InChIKey | OPEKHRGERHDLRK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(Nc2ccc(C(C)(C)C)cc2)cc1 |
| Water Solubility | Insuluble (1.6E-4 g/L) (25 ºC) |
| Hazard Codes | F+ |
|---|---|
| HS Code | 2921499090 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4,4'-Di-tert-butyldiphenylamine |
| Bis(4-tert-butylphenyl)aMine |
| 4-tert-butyl-N-(4-tert-butylphenyl)aniline |