4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl N-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxycarbonylimino)carbamate
Modify Date: 2025-08-25 17:24:36
4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl N-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxycarbonylimino)carbamate structure
|
Common Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl N-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxycarbonylimino)carbamate | ||
|---|---|---|---|---|
| CAS Number | 462996-01-6 | Molecular Weight | 838.27900 | |
| Density | 1.644g/cm3 | Boiling Point | 410.666ºC at 760 mmHg | |
| Molecular Formula | C20H12F26N2O4 | Melting Point | 56-60ºC | |
| MSDS | USA | Flash Point | 202.164ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl N-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxycarbonylimino)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.644g/cm3 |
|---|---|
| Boiling Point | 410.666ºC at 760 mmHg |
| Melting Point | 56-60ºC |
| Molecular Formula | C20H12F26N2O4 |
| Molecular Weight | 838.27900 |
| Flash Point | 202.164ºC |
| Exact Mass | 838.03800 |
| PSA | 77.32000 |
| LogP | 10.74980 |
| Index of Refraction | 1.345 |
| InChIKey | DYPPJKHPJMGHKW-QJGAVIKSSA-N |
| SMILES | O=C(N=NC(=O)OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26;S36 |
| RIDADR | NONH for all modes of transport |
| Bis(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl) azodicarboxylate |
| MFCD06411718 |
| 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl (NE)-N-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxycarbonylimino)carbamate |