1,4-Benzenedicarboxylicacid, 1,4-di-2-propyn-1-yl ester structure
|
Common Name | 1,4-Benzenedicarboxylicacid, 1,4-di-2-propyn-1-yl ester | ||
|---|---|---|---|---|
| CAS Number | 4631-69-0 | Molecular Weight | 242.22700 | |
| Density | 1.218g/cm3 | Boiling Point | 376.3ºC at 760mmHg | |
| Molecular Formula | C14H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.4ºC | |
| Name | bis(prop-2-ynyl) benzene-1,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 376.3ºC at 760mmHg |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.22700 |
| Flash Point | 189.4ºC |
| Exact Mass | 242.05800 |
| PSA | 52.60000 |
| LogP | 1.26660 |
| Index of Refraction | 1.556 |
| InChIKey | HZTNYDWTDTYXQC-UHFFFAOYSA-N |
| SMILES | C#CCOC(=O)c1ccc(C(=O)OCC#C)cc1 |
| HS Code | 2917399090 |
|---|
|
~92%
1,4-Benzenedica... CAS#:4631-69-0 |
| Literature: Vereschagin, L. I.; Bol'shedovorskaya, R. L.; Maksikova, A. V.; Serebryakova, E. S.; Kozyrev, S. V.; et al. Journal of Organic Chemistry USSR (English Translation), 1987 , vol. 23, # 11 p. 2030 - 2033 Zhurnal Organicheskoi Khimii, 1986 , vol. 23, # 11 p. 2303 - 2307 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,4-Benzenedicarboxylicacid,1,4-di-2-propyn-1-yl ester |
| DIPROP-2-YNYL BENZENE-1,4-DICARBOXYLATE |
| Terephthalsaeure-di-prop-2-inylester |
| Terephthalsaeure-dipropinylester |
| Dipropargyl terephthalate |
| terephthalic acid di-prop-2-ynyl ester |
| Terephthalsaeure-dipropargylester |