Methyl 6-phenylpyridin-3-ylcarboxylate
Methyl 6-phenylpyridin-3-ylcarboxylate structure
|
Common Name | Methyl 6-phenylpyridin-3-ylcarboxylate | ||
|---|---|---|---|---|
| CAS Number | 4634-13-3 | Molecular Weight | 213.23200 | |
| Density | 1.147g/cm3 | Boiling Point | 336.2ºC at 760mmHg | |
| Molecular Formula | C13H11NO2 | Melting Point | >1100ºC(dec.) | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 6-phenylpyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.147g/cm3 |
|---|---|
| Boiling Point | 336.2ºC at 760mmHg |
| Melting Point | >1100ºC(dec.) |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.23200 |
| Exact Mass | 213.07900 |
| PSA | 39.19000 |
| LogP | 2.53520 |
| Index of Refraction | 1.567 |
| InChIKey | DXHZSBAEWGPUKI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(-c2ccccc2)nc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 3 | |
CAS#:67-56-1
CAS#:63056-20-2
CAS#:73781-91-6
CAS#:98-80-6
CAS#:108-86-1
CAS#:26218-78-0
CAS#:1078-58-6
CAS#:29051-44-3
CAS#:1211000-48-4
CAS#:93-60-7
CAS#:4634-09-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Methyl 6-phenylnicotinate |
| 6-phenylpyridine-3-carboxylic acid methyl ester |
| 6-phenyl-nicotinic acid methyl ester |
| methyl 6-phenyl-3-pyridinecarboxylate |
| methyl 2-phenyl-5-pyridinecarboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of methyl 6-phenylpyridine-3-carboxylate? |
| A: LogP of methyl 6-phenylpyridine-3-carboxylate is 2.53520. |
| Q: What are the downstream products of methyl 6-phenylpyridine-3-carboxylate? |
| A: Related downstream products(CAS) of methyl 6-phenylpyridine-3-carboxylate: 63056-20-2;29051-44-3;4634-09-7. |
| Q: What is the English name of methyl 6-phenylpyridine-3-carboxylate? |
| A: The English name of methyl 6-phenylpyridine-3-carboxylate is methyl 6-phenylpyridine-3-carboxylate. |
| Q: What is the polar surface area (PSA) of methyl 6-phenylpyridine-3-carboxylate? |
| A: Polar surface area (PSA) of methyl 6-phenylpyridine-3-carboxylate is 39.19000. |
| Q: What are the upstream materials of methyl 6-phenylpyridine-3-carboxylate? |
| A: Related upstream materials(CAS) of methyl 6-phenylpyridine-3-carboxylate: 67-56-1;63056-20-2;73781-91-6;98-80-6;108-86-1;26218-78-0;1078-58-6;29051-44-3;1211000-48-4;93-60-7. |
| Q: What is the molecular formula of methyl 6-phenylpyridine-3-carboxylate? |
| A: Molecular formula of methyl 6-phenylpyridine-3-carboxylate is C13H11NO2. |
| Q: What is the CAS number of methyl 6-phenylpyridine-3-carboxylate? |
| A: CAS number of methyl 6-phenylpyridine-3-carboxylate is 4634-13-3. |
| Q: What is the molecular weight of methyl 6-phenylpyridine-3-carboxylate? |
| A: Molecular weight of methyl 6-phenylpyridine-3-carboxylate is 213.23200. |
| Q: What is the boiling point of methyl 6-phenylpyridine-3-carboxylate? |
| A: Boiling point of methyl 6-phenylpyridine-3-carboxylate is 336.2ºC at 760mmHg. |
| Q: What is the SMILES notation of methyl 6-phenylpyridine-3-carboxylate? |
| A: SMILES notation of methyl 6-phenylpyridine-3-carboxylate is COC(=O)c1ccc(-c2ccccc2)nc1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |