Decanedioic acid,1,10-bis[(tetrahydro-2-furanyl)methyl] ester
Modify Date: 2025-09-26 17:18:06
![Decanedioic acid,1,10-bis[(tetrahydro-2-furanyl)methyl] ester Structure](https://image.chemsrc.com/caspic/276/4650-79-7.png)
Decanedioic acid,1,10-bis[(tetrahydro-2-furanyl)methyl] ester structure
|
Common Name | Decanedioic acid,1,10-bis[(tetrahydro-2-furanyl)methyl] ester | ||
|---|---|---|---|---|
| CAS Number | 4650-79-7 | Molecular Weight | 370.48000 | |
| Density | 1.073g/cm3 | Boiling Point | 445.7ºC at 760 mmHg | |
| Molecular Formula | C20H34O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.7ºC | |
| Name | bis(oxolan-2-ylmethyl) decanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.073g/cm3 |
|---|---|
| Boiling Point | 445.7ºC at 760 mmHg |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.48000 |
| Flash Point | 190.7ºC |
| Exact Mass | 370.23600 |
| PSA | 71.06000 |
| LogP | 3.55160 |
| Index of Refraction | 1.475 |
| InChIKey | RHWOXBBBVFKHAN-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCCCCC(=O)OCC1CCCO1)OCC1CCCO1 |
| HS Code | 2932190090 |
|---|
|
~%
Decanedioic aci... CAS#:4650-79-7 |
| Literature: Iwakura Kobunshi Kagaku, 1945 , vol. 2, p. 287,296 Chem.Abstr., 1950 , p. 5144 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Sebazinsaeure-bis-tetrahydrofurfurylester |
| sebacic acid bis-tetrahydrofurfuryl ester |
| EINECS 225-080-6 |
| decanedioic acid bis-tetrahydrofurfuryl ester |
| Sebacinsaeure-ditetrahydrofurfurylester |
| Sebacinsaeure-bis-tetrahydrofurfurylester |