Tetra-n-hexylammonium perchlorate structure
|
Common Name | Tetra-n-hexylammonium perchlorate | ||
|---|---|---|---|---|
| CAS Number | 4656-81-9 | Molecular Weight | 454.12700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H52ClNO4 | Melting Point | 110-113ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tetrahexylazanium,perchlorate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 110-113ºC |
|---|---|
| Molecular Formula | C24H52ClNO4 |
| Molecular Weight | 454.12700 |
| Exact Mass | 453.35800 |
| PSA | 74.27000 |
| LogP | 8.33870 |
| InChIKey | RLCKPGXHGKSGOS-UHFFFAOYSA-M |
| SMILES | CCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC.[O-][Cl+3]([O-])([O-])[O-] |
| Hazard Codes | O,Xi |
|---|---|
| Risk Phrases | 8-36/37/38 |
| Safety Phrases | 17-26-36 |
| RIDADR | UN1479 |
| Packaging Group | II |
| Hazard Class | 5.1 |
| HS Code | 2923900090 |
|
~%
Tetra-n-hexylam... CAS#:4656-81-9 |
| Literature: Goga, Sergey T.; Lebed, Alexander V.; McHedlov-Petrossyan, Nikolay O. Journal of Chemical and Engineering Data, 2010 , vol. 55, # 5 p. 1887 - 1892 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| tetrahexylazanium perchlorate |
| Tetra-n-hexylammonium perchlorate |
| perchlorate de tetrahexylammonium |
| MFCD00043185 |
| tetrahexylammonium perchlorate |
| Tetrahexylammoniumhydroxyd |
| EINECS 225-095-8 |
| n,n,n-trihexylhexan-1-aminiumperchlorate |