2,3,5,6-tetramethylbenzenesulfonic acid structure
|
Common Name | 2,3,5,6-tetramethylbenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 4681-78-1 | Molecular Weight | 214.28100 | |
| Density | 1.208g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H14O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,5,6-tetramethylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.208g/cm3 |
|---|---|
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.28100 |
| Exact Mass | 214.06600 |
| PSA | 62.75000 |
| LogP | 3.24770 |
| Index of Refraction | 1.539 |
| InChIKey | KJJMOCUMRBSKTE-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)O)c1C |
|
~%
2,3,5,6-tetrame... CAS#:4681-78-1 |
| Literature: Smith; Cass Journal of the American Chemical Society, 1932 , vol. 54, p. 1609,1611 |
|
~99%
2,3,5,6-tetrame... CAS#:4681-78-1 |
| Literature: Koeberg-Telder, Ankie; Cerfontain, Hans Recueil: Journal of the Royal Netherlands Chemical Society, 1982 , vol. 101, # 1 p. 41 - 47 |
| 2,3,5,6-tetramethyl-aniline |
| 2,3,5,6-tetramethylphenylamine |
| 2,3,5,6-tetramethylbenzene-1-sulfonic acid |
| 2,3,5,6-tetramethylbenzenamine |
| 1,2,4,5-Tetramethyl-benzol-3-sulfonsaeure |
| 2,3,5,6-Tetramethylanilin |
| 2,3,5,6-Tetramethyl-aminobenzen |
| 1,2,4,5-Tetramethylbenzol-sulfonsaeure |
| aminodurene |
| 2,3,5,6-tetramethyl-benzenesulfonic acid |
| 2,3,5,6-Tetramethyl-benzolsulfonsaeure |
| 1,2,4,5-tetramethylbenzene-3-sulfonic acid |