Cycloeucalenol structure
|
Common Name | Cycloeucalenol | ||
|---|---|---|---|---|
| CAS Number | 469-39-6 | Molecular Weight | 426.717 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 508.0±19.0 °C at 760 mmHg | |
| Molecular Formula | C30H50O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.7±13.7 °C | |
Use of CycloeucalenolCycloeucalenol is a triterpenoid compound derived from Eucalyptus microcorys[1]. |
| Name | cycloeucalenol |
|---|---|
| Synonym | More Synonyms |
| Description | Cycloeucalenol is a triterpenoid compound derived from Eucalyptus microcorys[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 508.0±19.0 °C at 760 mmHg |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.717 |
| Flash Point | 222.7±13.7 °C |
| Exact Mass | 426.386169 |
| PSA | 20.23000 |
| LogP | 10.54 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | HUNLTIZKNQDZEI-PGFZVWMDSA-N |
| SMILES | C=C(CCC(C)C1CCC2(C)C3CCC4C(C)C(O)CCC45CC35CCC12C)C(C)C |
| Hazard Codes | Xi |
|---|
| (3β,4α,5α,9β)-4,14-Dimethyl-9,19-cycloergost-24(28)-en-3-ol |
| 9,19-Cycloergost-24(28)-en-3-ol, 4,14-dimethyl-, (3β,4α,5α,9β)- |
| Cycloeucalenol |