(-)-thujopsene structure
|
Common Name | (-)-thujopsene | ||
|---|---|---|---|---|
| CAS Number | 470-40-6 | Molecular Weight | 204.35100 | |
| Density | 0.95g/cm3 | Boiling Point | 256.5ºC at 760mmHg | |
| Molecular Formula | C15H24 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 105.9ºC | |
| Name | (-)-thujopsene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.95g/cm3 |
|---|---|
| Boiling Point | 256.5ºC at 760mmHg |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35100 |
| Flash Point | 105.9ºC |
| Exact Mass | 204.18800 |
| LogP | 4.55910 |
| Index of Refraction | n20/D 1.505 |
| InChIKey | WXQGPFZDVCRBME-JENMUQSASA-N |
| SMILES | CC1=CCC2(C)CCCC(C)(C)C23CC13 |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| Safety Phrases | S23 |
| RIDADR | UN 1993 |
| Packaging Group | III |
| Hazard Class | 3.2 |
|
Volatile signalling by sesquiterpenes from ectomycorrhizal fungi reprogrammes root architecture.
Nat. Commun. 6 , 6279, (2015) The mutualistic association of roots with ectomycorrhizal fungi promotes plant health and is a hallmark of boreal and temperate forests worldwide. In the pre-colonization phase, before direct contact,... |
| cis-Thujopsene |
| Sesquichamene |
| EINECS 207-426-8 |
| (1aS,4aS,8aS)-2,4a,8,8-tetramethyl-1,1a,4,5,6,7-hexahydrocyclopropa[j]naphthalene |