7-Methoxy-2-methylquinoline-3-carboxylic acid
Modify Date: 2025-08-25 16:16:34
7-Methoxy-2-methylquinoline-3-carboxylic acid structure
|
Common Name | 7-Methoxy-2-methylquinoline-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 470702-34-2 | Molecular Weight | 217.22100 | |
| Density | 1.28g/cm3 | Boiling Point | 379.8ºC at 760 mmHg | |
| Molecular Formula | C12H11NO3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 183.5ºC | |
| Name | 7-Methoxy-2-methylquinoline-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 379.8ºC at 760 mmHg |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22100 |
| Flash Point | 183.5ºC |
| Exact Mass | 217.07400 |
| PSA | 59.42000 |
| LogP | 2.25000 |
| Index of Refraction | 1.633 |
| InChIKey | XBQMSEMHUXMTQF-UHFFFAOYSA-N |
| SMILES | COc1ccc2cc(C(=O)O)c(C)nc2c1 |
| Hazard Codes | Xi |
|---|
|
~%
7-Methoxy-2-met... CAS#:470702-34-2 |
| Literature: US2005/43352 A1, ; Page/Page column 16 ; US 20050043352 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
Total 3, Current Page 1 of 1
1
| 7-Methoxy-2-methyl-quinoline-3-carboxylic acid |
| 2-Methyl 7-methoxy-quinoline-3-carboxylic acid |