4-bromo-6-[[(4-ethoxyphenyl)amino]methylidene]cyclohexa-2,4-dien-1-one structure
|
Common Name | 4-bromo-6-[[(4-ethoxyphenyl)amino]methylidene]cyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 4718-19-8 | Molecular Weight | 320.18100 | |
| Density | 1.547g/cm3 | Boiling Point | 395.2ºC at 760 mmHg | |
| Molecular Formula | C15H14BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.8ºC | |
| Name | (6E)-4-bromo-6-[(4-ethoxyanilino)methylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.547g/cm3 |
|---|---|
| Boiling Point | 395.2ºC at 760 mmHg |
| Molecular Formula | C15H14BrNO2 |
| Molecular Weight | 320.18100 |
| Flash Point | 192.8ºC |
| Exact Mass | 319.02100 |
| PSA | 41.82000 |
| LogP | 4.30400 |
| Index of Refraction | 1.717 |
| InChIKey | RWTSBLZRCLRZSA-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(N=Cc2cc(Br)ccc2O)cc1 |
|
~%
4-bromo-6-[[(4-... CAS#:4718-19-8 |
| Literature: Brewster; Millam Journal of the American Chemical Society, 1933 , vol. 55, p. 763,765 |
|
~%
4-bromo-6-[[(4-... CAS#:4718-19-8 |
| Literature: Brewster; Millam Journal of the American Chemical Society, 1933 , vol. 55, p. 763,765 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-<5-Brom-2-hydroxy-benzyliden>-p-phenetidin |