4-(trifluoromethylsulfonyl)benzenamine structure
|
Common Name | 4-(trifluoromethylsulfonyl)benzenamine | ||
|---|---|---|---|---|
| CAS Number | 473-27-8 | Molecular Weight | 225.18800 | |
| Density | 1.502g/cm3 | Boiling Point | 317.8ºC at 760mmHg | |
| Molecular Formula | C7H6F3NO2S | Melting Point | 96 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 146ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(trifluoromethylsulfonyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.502g/cm3 |
|---|---|
| Boiling Point | 317.8ºC at 760mmHg |
| Melting Point | 96 °C(lit.) |
| Molecular Formula | C7H6F3NO2S |
| Molecular Weight | 225.18800 |
| Flash Point | 146ºC |
| Exact Mass | 225.00700 |
| PSA | 68.54000 |
| LogP | 3.22430 |
| Vapour Pressure | 0.000376mmHg at 25°C |
| Index of Refraction | 1.501 |
| InChIKey | GNVFCXUZQGCXPB-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant;T: Toxic; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2921420090 |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Organic synthesis in soft wall-free microreactors: real-time monitoring of fluorogenic reactions. Marchand G, et al.
Anal. Chem. 80(15) , 6051-6055, (2008)
|
| 4-trifluoromethanesulfonyl-aniline |
| 4-Aminophenyl trifluoromethyl sulphone |
| 4-Trifluormethansulfonyl-anilin |
| MFCD00182685 |
| 4-trifluoromethanesulfonylphenylamine |
| 4-Aminophenyl trifluoromethyl sulfone |