1,1'-Diphenyl-4,4'-bipyridinium dichloride structure
|
Common Name | 1,1'-Diphenyl-4,4'-bipyridinium dichloride | ||
|---|---|---|---|---|
| CAS Number | 47369-00-6 | Molecular Weight | 381.298 | |
| Density | 1.043g/cm3 | Boiling Point | 451.1ºC at 760mmHg | |
| Molecular Formula | C22H18Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.9ºC | |
| Name | 1-phenyl-4-(1-phenylpyridin-1-ium-4-yl)pyridin-1-ium,dichloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.043g/cm3 |
|---|---|
| Boiling Point | 451.1ºC at 760mmHg |
| Molecular Formula | C22H18Cl2N2 |
| Molecular Weight | 381.298 |
| Flash Point | 201.9ºC |
| Exact Mass | 380.084717 |
| PSA | 7.76000 |
| Index of Refraction | 1.561 |
| InChIKey | SZZVUWLOZBMPLX-UHFFFAOYSA-L |
| SMILES | [Cl-].[Cl-].c1ccc(-[n+]2ccc(-c3cc[n+](-c4ccccc4)cc3)cc2)cc1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
|
~88%
1,1'-Diphenyl-4... CAS#:47369-00-6 |
| Literature: Kamogawa, Hiroyoshi; Sato, Shigeki Bulletin of the Chemical Society of Japan, 1991 , vol. 64, # 1 p. 321 - 323 |
|
~%
1,1'-Diphenyl-4... CAS#:47369-00-6 |
| Literature: Kamogawa, Hiroyoshi; Sato, Shigeki Bulletin of the Chemical Society of Japan, 1991 , vol. 64, # 1 p. 321 - 323 |
|
~%
1,1'-Diphenyl-4... CAS#:47369-00-6 |
| Literature: Kamogawa, Hiroyoshi; Sato, Shigeki Bulletin of the Chemical Society of Japan, 1991 , vol. 64, # 1 p. 321 - 323 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| D2165 |
| phenyl viologen dichloride |
| 4,4'-Bipyridinium, 1,1'-diphenyl-, dichloride |
| N,N'-diphenyl-4,4'-bipyridinium dichloride |
| 4,4'-Bipyridinium, 1,1'-diphenyl-, chloride (1:2) |
| 1,1'-Diphenyl-4,4'-bipyridinium dichloride |
| N,N'-diphenyl-4,4'-bipyridylium dichloride |