3-Fluoro-4-(Trifluoromethoxy)Benzaldehyde structure
|
Common Name | 3-Fluoro-4-(Trifluoromethoxy)Benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 473917-15-6 | Molecular Weight | 208.11000 | |
| Density | 1.428g/cm3 | Boiling Point | 201.6ºC at 760 mmHg | |
| Molecular Formula | C8H4F4O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 73.9ºC | |
| Name | 3-Fluoro-4-(Trifluoromethoxy)Benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.428g/cm3 |
|---|---|
| Boiling Point | 201.6ºC at 760 mmHg |
| Molecular Formula | C8H4F4O2 |
| Molecular Weight | 208.11000 |
| Flash Point | 73.9ºC |
| Exact Mass | 208.01500 |
| PSA | 26.30000 |
| LogP | 2.53680 |
| Index of Refraction | 1.4454 |
| InChIKey | RQLRUBHAAVGRPW-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(OC(F)(F)F)c(F)c1 |
| Hazard Codes | Xi,Xn |
|---|---|
| HS Code | 2913000090 |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 3-FLUORO-4-(TRIFLUOROMETHOXY)BENZALDEHYDE |
| 3-Fluoro-4-(trifluoromethoxy)benzaldehyde |