Fmoc-MMAE structure
|
Common Name | Fmoc-MMAE | ||
|---|---|---|---|---|
| CAS Number | 474645-26-6 | Molecular Weight | 940.22 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 1036.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C54H77N5O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 580.6±34.3 °C | |
Use of Fmoc-MMAEFmoc-MMAE is a protective group-conjugated monomethyl auristatin E (MMAE), which is a potent tubulin inhibitor. Fmoc-MMAE can be used in the synthesis of ADC[1]. |
| Name | N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-methyl-L-valyl-N-[(3R,4S,5S)-1-{(2S)-2-[(1R,2R)-3-{[(1S,2R)-1-hydroxy-1-phenyl-2-propanyl]amino}-1-methoxy-2-methyl-3-oxopropyl]-1-pyrrolidinyl}-3-methoxy-5-methyl-1-oxo-4-heptanyl]-N-methyl-L-valinamide |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-MMAE is a protective group-conjugated monomethyl auristatin E (MMAE), which is a potent tubulin inhibitor. Fmoc-MMAE can be used in the synthesis of ADC[1]. |
|---|---|
| Related Catalog | |
| Target |
Auristatin |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 1036.4±65.0 °C at 760 mmHg |
| Molecular Formula | C54H77N5O9 |
| Molecular Weight | 940.22 |
| Flash Point | 580.6±34.3 °C |
| Exact Mass | 939.572144 |
| LogP | 8.60 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | ZBRLIYBOHHIZKY-NMDVRVFRSA-N |
| SMILES | CCC(C)C(C(CC(=O)N1CCCC1C(OC)C(C)C(=O)NC(C)C(O)c1ccccc1)OC)N(C)C(=O)C(NC(=O)C(C(C)C)N(C)C(=O)OCC1c2ccccc2-c2ccccc21)C(C)C |
| L-Valinamide, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-N-methyl-L-valyl-N-[(1S,2R)-4-[(2S)-2-[(1R,2R)-3-[[(1R,2S)-2-hydroxy-1-methyl-2-phenylethyl]amino]-1-methoxy-2-methyl-3-oxopropyl]-1-pyrrolidinyl]-2-methoxy-1-[(1S)-1-methylpropyl]-4-oxobutyl]-N-methyl- |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-methyl-L-valyl-N-[(3R,4S,5S)-1-{(2S)-2-[(1R,2R)-3-{[(1S,2R)-1-hydroxy-1-phenyl-2-propanyl]amino}-1-methoxy-2-methyl-3-oxopropyl]-1-pyrrolidinyl}-3-methoxy-5-methyl-1-oxo-4-heptanyl]-N-methyl-L-valinamide |