3'-Hydroxypterostilbene structure
|
Common Name | 3'-Hydroxypterostilbene | ||
|---|---|---|---|---|
| CAS Number | 475231-21-1 | Molecular Weight | 272.296 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 469.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.8±28.7 °C | |
Use of 3'-Hydroxypterostilbene3'-Hydroxypterostilbene, a natural pterostilbene analogue, effectively inhibits the growth of human colon cancer cells (IC50s of 9.0, 40.2, and 70.9 µM for COLO 205, HCT-116, and HT-29 cells, respectively) by inducing apoptosis and autophagy. 3'-Hydroxypterostilbene inhibits the PI3K/Akt/mTOR/p70S6K, and p38MAPK pathways and activates the ERK1/2, JNK1/2 MAPK pathways[1]. |
| Name | 3'-Hydroxypterostilbene |
|---|---|
| Synonym | More Synonyms |
| Description | 3'-Hydroxypterostilbene, a natural pterostilbene analogue, effectively inhibits the growth of human colon cancer cells (IC50s of 9.0, 40.2, and 70.9 µM for COLO 205, HCT-116, and HT-29 cells, respectively) by inducing apoptosis and autophagy. 3'-Hydroxypterostilbene inhibits the PI3K/Akt/mTOR/p70S6K, and p38MAPK pathways and activates the ERK1/2, JNK1/2 MAPK pathways[1]. |
|---|---|
| Related Catalog | |
| Target |
Apoptosis[1] Autophagy[1] |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 469.7±45.0 °C at 760 mmHg |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.296 |
| Flash Point | 237.8±28.7 °C |
| Exact Mass | 272.104858 |
| PSA | 58.92000 |
| LogP | 3.68 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | UQRBFXIUUDJHSN-ONEGZZNKSA-N |
| SMILES | COc1cc(C=Cc2ccc(O)c(O)c2)cc(OC)c1 |
| Storage condition | -20℃ |
| 1,2-Benzenediol, 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]- |
| 4-[(E)-2-(3,5-Dimethoxyphenyl)vinyl]-1,2-benzenediol |
| 4-[2-(3,5-dimethoxyphenyl)ethenyl]benzene-1,2-diol |
| 4-(2-(3,5-dimethoxyphenyl)ethenyl)-1,2-benzenediol |
| 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]benzene-1,2-diol |
| 4-[(E)-2-(3,5-Dimethoxyphenyl)vinyl]benzene-1,2-diol |
| (E)-4-(3,5-Dimethoxystyryl)benzene-1,2-diol |