2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate
![2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate Structure](https://image.chemsrc.com/caspic/270/47662-72-6.png)
2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate structure
|
Common Name | 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 47662-72-6 | Molecular Weight | 432.94000 | |
| Density | 1.19g/cm3 | Boiling Point | 595.2ºC at 760 mmHg | |
| Molecular Formula | C23H29ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 595.2ºC at 760 mmHg |
| Molecular Formula | C23H29ClN2O4 |
| Molecular Weight | 432.94000 |
| Flash Point | 313.7ºC |
| Exact Mass | 432.18200 |
| PSA | 67.87000 |
| LogP | 4.70770 |
| Index of Refraction | 1.571 |
| InChIKey | NVOZYHBMINYHQA-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(=O)C(C)(C)Oc2ccccc2Cl)cc1 |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-(diethylamino... CAS#:47662-72-6 |
| Literature: Melandri,M. et al. Bollettino Chimico Farmaceutico, 1964 , vol. 103, p. 475 - 489 |
|
~%
2-(diethylamino... CAS#:47662-72-6 |
| Literature: Metz; Specker Arzneimittel-Forschung/Drug Research, 1975 , vol. 25, # 11 p. 1686 - 1692 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-(4-<2-Diethylamino-ethoxycarbonyl>-phenylcarbamoyl)-2-(4-chlor-phenoxy)-propan |
| 4-((2-(Chlorophenoxy)-2-methyl-1-oxopropyl)amino)benzoic acid 2-(diethylamino)ethyl ester |
| Benzoic acid,4-((2-(chlorophenoxy)-2-methyl-1-oxopropyl)amino)-,2-(diethylamino)ethyl ester |
| 2-diethylaminoethyl 4-[[2-(2-chlorophenoxy)-2-methyl-propanoyl]amino]benzoate |
| 4-<2-(p-Chlorphenoxy)-2-methylpropionylamino>-benzoesaeurediethylaminoethylester |
| ML 1037 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate? |
| A: LogP of 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate is 4.70770. |
| Q: What is the CAS number of 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate? |
| A: CAS number of 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate is 47662-72-6. |
| Q: What is the molecular weight of 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate? |
| A: Molecular weight of 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate is 432.94000. |
| Q: What is the English name of 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate? |
| A: The English name of 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate is 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate. |
| Q: What is the InChIKey of 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate? |
| A: InChIKey of 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate is NVOZYHBMINYHQA-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate? |
| A: Polar surface area (PSA) of 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate is 67.87000. |
| Q: What is the SMILES notation of 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate? |
| A: SMILES notation of 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate is CCN(CC)CCOC(=O)c1ccc(NC(=O)C(C)(C)Oc2ccccc2Cl)cc1. |
| Q: What is the Chinese name of 47662-72-6? |
| A: Chinese name of 47662-72-6 is 47662-72-6. |
| Q: What is the boiling point of 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate? |
| A: Boiling point of 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate is 595.2ºC at 760 mmHg. |
| Q: What is the molecular formula of 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate? |
| A: Molecular formula of 2-(diethylamino)ethyl 4-[[2-(2-chlorophenoxy)-2-methylpropanoyl]amino]benzoate is C23H29ClN2O4. |