Isochondrodendrine structure
|
Common Name | Isochondrodendrine | ||
|---|---|---|---|---|
| CAS Number | 477-62-3 | Molecular Weight | 594.69700 | |
| Density | 1.239g/cm3 | Boiling Point | 689ºC at 760 mmHg | |
| Molecular Formula | C36H38N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 370.5ºC | |
Use of IsochondrodendrineIsochondrodendrine ( Isochondrodendrin) is a class of bisbenzylisoquinoline alkaloid isolated from Isolona ghesquiereina. Isochondodendrine has strong antiplasmodial activity against Plasmodium falciparum[1]. |
| Name | Isochondrodendrine |
|---|---|
| Synonym | More Synonyms |
| Description | Isochondrodendrine ( Isochondrodendrin) is a class of bisbenzylisoquinoline alkaloid isolated from Isolona ghesquiereina. Isochondodendrine has strong antiplasmodial activity against Plasmodium falciparum[1]. |
|---|---|
| Related Catalog | |
| Target |
Plasmodium falciparum[1] |
| In Vivo | Isochondrodendrine has strong in vitro antiplasmodial activity against the chloroquine resistant strain FMC29 of Plasmodium falciparum. Toxicity observed is 50 to 100 fold greater towards Plasmodium falciparum than cultured L6 cells[1]. |
| References |
| Density | 1.239g/cm3 |
|---|---|
| Boiling Point | 689ºC at 760 mmHg |
| Molecular Formula | C36H38N2O6 |
| Molecular Weight | 594.69700 |
| Flash Point | 370.5ºC |
| Exact Mass | 594.27300 |
| PSA | 83.86000 |
| LogP | 6.43220 |
| Vapour Pressure | 1.28E-19mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | XIOGHHPVBVXQIV-VSGBNLITSA-N |
| SMILES | COc1cc2c3c(c1O)Oc1ccc(cc1)CC1c4c(cc(OC)c(O)c4Oc4ccc(cc4)CC3N(C)CC2)CCN1C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
|
Name: Antiamoebic activity against Entamoeba histolytica
Source: ChEMBL
Target: Entamoeba histolytica
External Id: CHEMBL3058937
|
|
Name: Antimalarial activity against Plasmodium falciparum
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL1177462
|
| Isobebeerine |
| d-Isochondodendrine |
| Isochondodendrine |
| Isochondodendrin |
| Isobebeerin |
| Isochondrodendrin |
| O7,O7'-didemethyl-cycleanine |
| O7,O7'-Didesmethyl-cycleanin |
| 6,6'-dimethoxy-2,2'-dimethyl-cycleanane-7,7'-diol |