3-Nitro-1H-indole structure
|
Common Name | 3-Nitro-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 4770-03-0 | Molecular Weight | 162.145 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 362.6±15.0 °C at 760 mmHg | |
| Molecular Formula | C8H6N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.1±20.4 °C | |
| Name | 3-Nitro-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 362.6±15.0 °C at 760 mmHg |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.145 |
| Flash Point | 173.1±20.4 °C |
| Exact Mass | 162.042923 |
| PSA | 61.61000 |
| LogP | 1.87 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.723 |
| InChIKey | LSMXNZJFLGIPMS-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c[nH]c2ccccc12 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| Precursor 8 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Nitro-1H-indole |
| 1H-Indole,3-nitro |
| 3-nitro-indole |
| 1H-Indole, 3-nitro- |
| 3-Nitro-indol |
| QC-5740 |
| 3-nitroindole |