Dimethylsilanediyl diacetate structure
|
Common Name | Dimethylsilanediyl diacetate | ||
|---|---|---|---|---|
| CAS Number | 4774-73-6 | Molecular Weight | 176.243 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 165.0±9.0 °C at 760 mmHg | |
| Molecular Formula | C6H12O4Si | Melting Point | -12.5ºC(lit.) | |
| MSDS | N/A | Flash Point | 44.7±14.3 °C | |
| Name | diazido(dimethyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 165.0±9.0 °C at 760 mmHg |
| Melting Point | -12.5ºC(lit.) |
| Molecular Formula | C6H12O4Si |
| Molecular Weight | 176.243 |
| Flash Point | 44.7±14.3 °C |
| Exact Mass | 176.050491 |
| PSA | 52.60000 |
| LogP | 1.30 |
| Vapour Pressure | 1.9±0.3 mmHg at 25°C |
| Index of Refraction | 1.409 |
| InChIKey | QYNWVPNBQDQHJF-UHFFFAOYSA-N |
| SMILES | C[Si](C)(N=[N+]=[N-])N=[N+]=[N-] |
| Storage condition | 2~8℃,Seal |
|
~78%
Dimethylsilaned... CAS#:4774-73-6 |
| Literature: Sukata, Kazuaki Journal of Organic Chemistry, 1988 , vol. 53, # 20 p. 4867 - 4869 |
|
~%
Dimethylsilaned... CAS#:4774-73-6 |
| Literature: Ruehlmann,K. et al. Chemische Berichte, 1965 , vol. 98, p. 1814 - 1818 |
|
~%
Dimethylsilaned... CAS#:4774-73-6 |
| Literature: Mueller,H.; Van Wazer,J.R. Journal of Organometallic Chemistry, 1970 , vol. 23, p. 395 - 402 |
| Dimethylsilanediyl diacetate |
| Silanediol, 1,1-dimethyl-, diacetate |
| EINECS 225-318-9 |
| Silane,diazidodimethyl |
| Silanediol, dimethyl-, diacetate |
| Di-azido-dimethyl-silan |
| Dimethyldiazidosilane |
| Diazidodimethylsilane |
| dimethylsilyl diazide |
| Dimethyl-diazido-silan |
| Diacetoxy Dimethylsilane |