N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-nitro-D-phenylalanine structure
|
Common Name | N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-nitro-D-phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 478183-71-0 | Molecular Weight | 432.425 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 690.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C24H20N2O6 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 371.1±31.5 °C | |
| Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-nitrophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 690.1±55.0 °C at 760 mmHg |
| Molecular Formula | C24H20N2O6 |
| Molecular Weight | 432.425 |
| Flash Point | 371.1±31.5 °C |
| Exact Mass | 432.132141 |
| PSA | 121.45000 |
| LogP | 5.14 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | UDIZJKKIJYRJIN-JOCHJYFZSA-N |
| SMILES | O=C(NC(Cc1cccc([N+](=O)[O-])c1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | Store at 0-5°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-nitro-D-phenylalanine |
| FMOC-D-3-NITROPHENYLALANINE |
| Fmoc-L-phe(3-NO2)-OH |
| MFCD01317715 |
| D-Phenylalanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-3-nitro- |
| Fmoc-3-nitro-D-phenylalanine |
| Fmoc-D-3-Nitrophe |