2'-Deoxycytidine-13C monohydrate structure
|
Common Name | 2'-Deoxycytidine-13C monohydrate | ||
|---|---|---|---|---|
| CAS Number | 478510-83-7 | Molecular Weight | 246.22500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H15N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2'-Deoxycytidine-13C monohydrate2'-Deoxycytidine-13C monohydrate is the 13C labeled 2'-Deoxycytidine[1]. |
| Name | [1'-13c]2'-deoxycytidine monohydrate |
|---|---|
| Synonym | More Synonyms |
| Description | 2'-Deoxycytidine-13C monohydrate is the 13C labeled 2'-Deoxycytidine[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C9H15N3O5 |
|---|---|
| Molecular Weight | 246.22500 |
| Exact Mass | 246.10500 |
| PSA | 119.83000 |
| InChIKey | HXBGOHZLZCFWLH-TXHSEDLPSA-N |
| SMILES | Nc1ccn(C2CC(O)C(CO)O2)c(=O)n1.O |
| 2'-Deoxycytidine-1'-13C Monohydrate |