4-[(3-Chloro-5-formyl-4,6-dihydroxy-2-methylbenzoyl)oxy]-2-hydroxy-3,6-dimethylbenzoic acid methyl ester structure
|
Common Name | 4-[(3-Chloro-5-formyl-4,6-dihydroxy-2-methylbenzoyl)oxy]-2-hydroxy-3,6-dimethylbenzoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 479-16-3 | Molecular Weight | 408.78600 | |
| Density | 1.467g/cm3 | Boiling Point | 548.2ºC at 760 mmHg | |
| Molecular Formula | C19H17ClO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.4ºC | |
| Name | (3-hydroxy-4-methoxycarbonyl-2,5-dimethylphenyl) 5-chloro-3-formyl-2,4-dihydroxy-6-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.467g/cm3 |
|---|---|
| Boiling Point | 548.2ºC at 760 mmHg |
| Molecular Formula | C19H17ClO8 |
| Molecular Weight | 408.78600 |
| Flash Point | 285.4ºC |
| Exact Mass | 408.06100 |
| PSA | 130.36000 |
| LogP | 3.20030 |
| Vapour Pressure | 1.25E-12mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | ABZLZZCDSLOCNF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(C)cc(OC(=O)c2c(C)c(Cl)c(O)c(C=O)c2O)c(C)c1O |
|
~%
4-[(3-Chloro-5-... CAS#:479-16-3 |
| Literature: Dias, Daniel A.; Urban, Sylvia Natural Product Research, 2009 , vol. 23, # 10 p. 925 - 939 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
|
Name: The chemical genetic matrix (CGM) dataset as reported in Wildenhain et al. (2015) Pre...
Source: 11924
Target: N/A
External Id: CGM data for Cell Systems paper Dec 2015
|
| 5-chloro-atranorin |
| 5-Chlor-atranorin |
| Chloratranorin |
| chloroantranorin |
| chloroatranorin |