2-chloro-4-fluoro-5-sulfamoylbenzoic acid structure
|
Common Name | 2-chloro-4-fluoro-5-sulfamoylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 4793-24-2 | Molecular Weight | 253.63500 | |
| Density | 1.724 g/cm3 | Boiling Point | 470ºC at 760mmHg | |
| Molecular Formula | C7H5ClFNO4S | Melting Point | 245-248ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 238.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-chloro-4-fluoro-5-sulfamoylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.724 g/cm3 |
|---|---|
| Boiling Point | 470ºC at 760mmHg |
| Melting Point | 245-248ºC(lit.) |
| Molecular Formula | C7H5ClFNO4S |
| Molecular Weight | 253.63500 |
| Flash Point | 238.1ºC |
| Exact Mass | 252.96100 |
| PSA | 105.84000 |
| LogP | 2.60580 |
| Index of Refraction | 1.601 |
| InChIKey | DDGOQDDPEWYVRD-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)c(Cl)cc1F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2935009090 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 2-Chloro-4-fluoro-5-sulfamoyl-benzoic acid |
| MFCD01321357 |
| 6-chloro-4-fluoro-3-sulfamoylbenzoic acid |