6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine
![6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine Structure](https://image.chemsrc.com/caspic/171/4794-44-9.png)
6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine structure
|
Common Name | 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine | ||
|---|---|---|---|---|
| CAS Number | 4794-44-9 | Molecular Weight | 355.17400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H8Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H8Cl2N2O2 |
|---|---|
| Molecular Weight | 355.17400 |
| Exact Mass | 353.99600 |
| PSA | 43.18000 |
| LogP | 3.97860 |
| InChIKey | LNKJCJLDSDOKDF-UHFFFAOYSA-N |
| SMILES | Clc1c2c(c(Cl)c3c1=Nc1ccccc1O3)=Nc1ccccc1O2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~89%
6,13-dichloro-[... CAS#:4794-44-9 |
| Literature: Xia, Min; Ye, Chunfang Journal of Chemical Research, Synopses, 1999 , # 10 p. 618 - 619 |
|
~%
6,13-dichloro-[... CAS#:4794-44-9 |
| Literature: Fierz-David; Brassel; Probst Helvetica Chimica Acta, 1939 , vol. 22, p. 1348,1351 |
|
~%
6,13-dichloro-[... CAS#:4794-44-9 |
| Literature: Fierz-David; Brassel; Probst Helvetica Chimica Acta, 1939 , vol. 22, p. 1348,1351 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6,13-Dichlortriphenodioxazin |
| 8,19-Dichlor-dioxazin |
| 6,13-dichlorotriphenodioxazine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine? |
| A: SMILES notation of 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine is Clc1c2c(c(Cl)c3c1=Nc1ccccc1O3)=Nc1ccccc1O2. |
| Q: What is the LogP of 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine? |
| A: LogP of 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine is 3.97860. |
| Q: What is the molecular weight of 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine? |
| A: Molecular weight of 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine is 355.17400. |
| Q: What are the upstream materials of 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine? |
| A: Related upstream materials(CAS) of 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine: 5030-67-1;90-04-0;118-75-2. |
| Q: What is the molecular formula of 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine? |
| A: Molecular formula of 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine is C18H8Cl2N2O2. |
| Q: What English synonyms does 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine have? |
| A: English synonyms of 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine: 6,13-Dichlortriphenodioxazin, 8,19-Dichlor-dioxazin, 6,13-dichlorotriphenodioxazine. |
| Q: What is the InChIKey of 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine? |
| A: InChIKey of 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine is LNKJCJLDSDOKDF-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 4794-44-9? |
| A: Chinese name of 4794-44-9 is 4794-44-9. |
| Q: What is the English name of 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine? |
| A: The English name of 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine is 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine. |
| Q: What is the polar surface area (PSA) of 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine? |
| A: Polar surface area (PSA) of 6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine is 43.18000. |