2,5-Cyclohexadiene-1,4-dione,2,5-dichloro-3,6-bis(phenylamino)- structure
|
Common Name | 2,5-Cyclohexadiene-1,4-dione,2,5-dichloro-3,6-bis(phenylamino)- | ||
|---|---|---|---|---|
| CAS Number | 5030-67-1 | Molecular Weight | 359.20600 | |
| Density | 1.44g/cm3 | Boiling Point | 472.8ºC at 760mmHg | |
| Molecular Formula | C18H12Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.7ºC | |
| Name | 2,5-Dianilino-3,6-dichloroquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 472.8ºC at 760mmHg |
| Molecular Formula | C18H12Cl2N2O2 |
| Molecular Weight | 359.20600 |
| Flash Point | 239.7ºC |
| Exact Mass | 358.02800 |
| PSA | 58.20000 |
| LogP | 4.40920 |
| Index of Refraction | 1.677 |
| InChIKey | GLYBJBRBLQVBDK-UHFFFAOYSA-N |
| SMILES | O=C1C(Cl)=C(Nc2ccccc2)C(=O)C(Cl)=C1Nc1ccccc1 |
| HS Code | 2922399090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| C.I.Vat Brown 24 |
| 3.6-Dichlor-2.5-dianilino-p-chinon |
| C.I.Vat Brown 34 |
| 2,5-Dianilino-3,6-dichloro-p-benzoquinone |
| helindonbraun CM,CV |