4-(4,5-diphenyl-1H-imidazol-2-yl)benzaldehyde structure
|
Common Name | 4-(4,5-diphenyl-1H-imidazol-2-yl)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 479416-96-1 | Molecular Weight | 324.37500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4,5-diphenyl-1H-imidazol-2-yl)benzaldehyde |
|---|
| Molecular Formula | C22H16N2O |
|---|---|
| Molecular Weight | 324.37500 |
| Exact Mass | 324.12600 |
| PSA | 45.75000 |
| LogP | 5.22320 |
| InChIKey | GKNKKYRULMLSNM-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1 |
|
~98%
4-(4,5-diphenyl... CAS#:479416-96-1 |
| Literature: Khosropour, Ahmad R. Canadian Journal of Chemistry, 2008 , vol. 86, # 3 p. 264 - 269 |
|
~96%
4-(4,5-diphenyl... CAS#:479416-96-1 |
| Literature: Khosropour, Ahmad R. Canadian Journal of Chemistry, 2008 , vol. 86, # 3 p. 264 - 269 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |