1,5-bis(2,3-epoxypropoxy)-2,2,3,3,4,4-hexafluoropentane structure
|
Common Name | 1,5-bis(2,3-epoxypropoxy)-2,2,3,3,4,4-hexafluoropentane | ||
|---|---|---|---|---|
| CAS Number | 4798-39-4 | Molecular Weight | 324.21700 | |
| Density | 1.408g/cm3 | Boiling Point | 341.2ºC at 760 mmHg | |
| Molecular Formula | C11H14F6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.3ºC | |
| Name | 2-[[2,2,3,3,4,4-hexafluoro-5-(oxiran-2-ylmethoxy)pentoxy]methyl]oxirane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.408g/cm3 |
|---|---|
| Boiling Point | 341.2ºC at 760 mmHg |
| Molecular Formula | C11H14F6O4 |
| Molecular Weight | 324.21700 |
| Flash Point | 168.3ºC |
| Exact Mass | 324.08000 |
| PSA | 43.52000 |
| LogP | 1.72310 |
| Index of Refraction | 1.405 |
| InChIKey | OIGSRLUDJHIAPI-UHFFFAOYSA-N |
| SMILES | FC(F)(COCC1CO1)C(F)(F)C(F)(F)COCC1CO1 |
|
~69%
1,5-bis(2,3-epo... CAS#:4798-39-4 |
| Literature: Serrurier, Cecile Bassilana; Cambon, Aime Journal of Fluorine Chemistry, 1998 , vol. 87, # 1 p. 37 - 40 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| einecs 225-354-5 |