1,5-Pentanediol,2,2,3,3,4,4-hexafluoro structure
|
Common Name | 1,5-Pentanediol,2,2,3,3,4,4-hexafluoro | ||
|---|---|---|---|---|
| CAS Number | 376-90-9 | Molecular Weight | 212.09000 | |
| Density | 1.526 g/cm3 | Boiling Point | 111.5 °C10 mm Hg(lit.) | |
| Molecular Formula | C5H6F6O2 | Melting Point | 78-81 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | >110°C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,2,3,3,4,4-hexafluoro-1,5-pentanediol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.526 g/cm3 |
|---|---|
| Boiling Point | 111.5 °C10 mm Hg(lit.) |
| Melting Point | 78-81 °C(lit.) |
| Molecular Formula | C5H6F6O2 |
| Molecular Weight | 212.09000 |
| Flash Point | >110°C |
| Exact Mass | 212.02700 |
| PSA | 40.46000 |
| LogP | 0.87690 |
| Index of Refraction | 1.34 |
| InChIKey | IELVMUPSWDZWSD-UHFFFAOYSA-N |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)CO |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful;Xi: Irritant;T: Toxic; |
| Risk Phrases | R22 |
| Safety Phrases | S36 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| RTECS | SA0750000 |
| HS Code | 2905590090 |
|
~%
1,5-Pentanediol... CAS#:376-90-9 |
| Literature: Dobina,Kh.A. et al. J. Appl. Chem. USSR (Engl. Transl.), 1973 , vol. 46, p. 687 - 689,732 - 734 |
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Inorg. Chem. 33 , 415, (1994)
|
|
|
Inorg. Chem. , 5463
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2,2,3,3,4,4-hexafluoropentane-1,5-diol |
| 2,2,3,3,4,4-Hexafluoro-1,5-pentanediol |
| 1,5-Dihydroxy-2,2,3,3,4,4-hexafluoropentane |
| EINECS 206-819-1 |
| MFCD00042434 |