Alpinone
Alpinone structure
|
Common Name | Alpinone | ||
|---|---|---|---|---|
| CAS Number | 480-13-7 | Molecular Weight | 286.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H14O5 |
|---|---|
| Molecular Weight | 286.27900 |
| Exact Mass | 286.08400 |
| PSA | 75.99000 |
| LogP | 2.07810 |
| InChIKey | QPOCKDYYXFOBCM-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(c1)OC(c1ccccc1)C(O)C2=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:480-14-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| pinobanksin-7-methyl ether |
| Flavanone,3,5-dihydroxy-7-methoxy |
| 7-O-Methylpinobanksin |
| Alpinone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one have? |
| A: English synonyms of 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one: pinobanksin-7-methyl ether, Flavanone,3,5-dihydroxy-7-methoxy, 7-O-Methylpinobanksin, Alpinone. |
| Q: What are the downstream products of 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one? |
| A: Related downstream products(CAS) of 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one: 480-14-8. |
| Q: What is the polar surface area (PSA) of 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one? |
| A: Polar surface area (PSA) of 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one is 75.99000. |
| Q: What is the CAS number of 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one? |
| A: CAS number of 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one is 480-13-7. |
| Q: What is the molecular weight of 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one? |
| A: Molecular weight of 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one is 286.27900. |
| Q: What is the molecular formula of 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one? |
| A: Molecular formula of 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one is C16H14O5. |
| Q: What is the SMILES notation of 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one? |
| A: SMILES notation of 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one is COc1cc(O)c2c(c1)OC(c1ccccc1)C(O)C2=O. |
| Q: What is the InChIKey of 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one? |
| A: InChIKey of 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one is QPOCKDYYXFOBCM-UHFFFAOYSA-N. |
| Q: What is the LogP of 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one? |
| A: LogP of 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one is 2.07810. |
| Q: What is the English name of 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one? |
| A: The English name of 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one is 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| BioBioPha |