5,6-dimethoxy-2-(pyridin-4-ylmethyl)-2,3-dihydroinden-1-one structure
|
Common Name | 5,6-dimethoxy-2-(pyridin-4-ylmethyl)-2,3-dihydroinden-1-one | ||
|---|---|---|---|---|
| CAS Number | 4803-57-0 | Molecular Weight | 283.32200 | |
| Density | 1.208g/cm3 | Boiling Point | 474.965ºC at 760 mmHg | |
| Molecular Formula | C17H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.05ºC | |
| Name | 5,6-dimethoxy-2-(pyridin-4-ylmethyl)-2,3-dihydroinden-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.208g/cm3 |
|---|---|
| Boiling Point | 474.965ºC at 760 mmHg |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.32200 |
| Flash Point | 241.05ºC |
| Exact Mass | 283.12100 |
| PSA | 48.42000 |
| LogP | 2.69650 |
| Index of Refraction | 1.59 |
| InChIKey | RGPDMDJBVKHZFW-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)C(=O)C(Cc1ccncc1)C2 |
| Storage condition | 2-8℃ |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,6-DIMETHOXY-2-PYRIDIN-4-YLMETHYL-INDAN-1-ONE |
| AC-1340 |
| UNII-6J7IV2Z5L0 |
| 5,6-Dimethoxy-2-pyridin-4-ylmethyl |
| Donepezil Impurity 7 |