Fluorescein O-methacrylate structure
|
Common Name | Fluorescein O-methacrylate | ||
|---|---|---|---|---|
| CAS Number | 480439-15-4 | Molecular Weight | 400.38000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H16O6 | Melting Point | 227-232ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 227-232ºC(lit.) |
|---|---|
| Molecular Formula | C24H16O6 |
| Molecular Weight | 400.38000 |
| Exact Mass | 400.09500 |
| PSA | 82.06000 |
| LogP | 4.44170 |
| InChIKey | YMHPNLUYVDEYCI-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)Oc1ccc2c(c1)Oc1cc(O)ccc1C21OC(=O)c2ccccc21 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-28 |
| RIDADR | NONH for all modes of transport |
|
Enhanced transcellular penetration and drug delivery by crosslinked polymeric micelles into pancreatic multicellular tumor spheroids.
Biomater. Sci. 3 , 1085-95, (2015) Many attempts have been made in the application of multicellular tumor spheroids (MCTS) as a 3D tumor model to investigate their biological responses upon introduction of polymeric micelles as nanocar... |
| 3'-Methacryloxyspirobenzo[c]-furan[1,9']xanthen-3-one |
| Fluorescein O-methacrylate |
| Methacryloyloxy fluorescein |
| 6'-hydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthen]-3'-yl 2-methylprop-2-enoate |
| MFCD04974071 |