diethyl 5-acetamido-3-methyl-thiophene-2,4-dicarboxylate structure
|
Common Name | diethyl 5-acetamido-3-methyl-thiophene-2,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 4815-41-2 | Molecular Weight | 299.34300 | |
| Density | 1.262g/cm3 | Boiling Point | 456.5ºC at 760 mmHg | |
| Molecular Formula | C13H17NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.9ºC | |
| Name | diethyl 5-acetamido-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 456.5ºC at 760 mmHg |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.34300 |
| Flash Point | 229.9ºC |
| Exact Mass | 299.08300 |
| PSA | 109.94000 |
| LogP | 2.44130 |
| Index of Refraction | 1.559 |
| InChIKey | DSAAXKNXXOMQNQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1sc(NC(C)=O)c(C(=O)OCC)c1C |
| HS Code | 2934999090 |
|---|
|
~%
diethyl 5-aceta... CAS#:4815-41-2 |
| Literature: Hoffmann-La Roche Inc. Patent: US4061656 A1, 1977 ; |
|
~87%
diethyl 5-aceta... CAS#:4815-41-2 |
| Literature: Hafez; El-Gazzar Bioorganic and Medicinal Chemistry Letters, 2008 , vol. 18, # 19 p. 5222 - 5227 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-diethoxycarbonyl-3-methyl-5-acetylamino-thiophene |
| 3,5-diethyl 2-acetylamino-4-methylthiophenedicarboxylate |