Diethyl 5-amino-3-methylthiophene-2,4-dicarboxylate structure
|
Common Name | Diethyl 5-amino-3-methylthiophene-2,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 4815-30-9 | Molecular Weight | 257.30600 | |
| Density | 1.247 g/cm3 | Boiling Point | 372.6ºC at 760 mmHg | |
| Molecular Formula | C11H15NO4S | Melting Point | 105-108 °C(lit.) | |
| MSDS | N/A | Flash Point | 179.1ºC | |
| Name | 2-Amino-3,5-Bis(Ethoxycarbonyl)-4-Methylthiophene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.247 g/cm3 |
|---|---|
| Boiling Point | 372.6ºC at 760 mmHg |
| Melting Point | 105-108 °C(lit.) |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.30600 |
| Flash Point | 179.1ºC |
| Exact Mass | 257.07200 |
| PSA | 106.86000 |
| LogP | 2.57330 |
| Index of Refraction | 1.558 |
| InChIKey | DGVXLHAJVRRLGV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1sc(N)c(C(=O)OCC)c1C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2934999090 |
|
~81%
Diethyl 5-amino... CAS#:4815-30-9 |
| Literature: Mobinikhaledi; Kalhor; Taheri Asian Journal of Chemistry, 2010 , vol. 22, # 9 p. 7399 - 7404 |
|
~%
Diethyl 5-amino... CAS#:4815-30-9 |
| Literature: Hu, Yi; Wei, Ping; Huang, He; Han, Shi-Qing; Ouyang, Ping-Kai Synthetic Communications, 2006 , vol. 36, # 11 p. 1543 - 1548 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| diethyl 5-amino-3-methylthiophene-2,4-dicarboxylate |
| MFCD00005450 |
| EINECS 225-388-0 |
| Diethyl 5-Amino-3-methyl-2,4-thiophenedicarboxylate |
| 5-Amino-3-methyl-2,4-thiophenedicarboxylic Acid Diethyl Ester |
| 2-Amino-3,5-bis(ethoxycarbonyl)-4-methylthiophene |