(2S)-4-(1,3-Dioxoisoindolin-2-yl)-2-hydroxybutanoic acid structure
|
Common Name | (2S)-4-(1,3-Dioxoisoindolin-2-yl)-2-hydroxybutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 48172-10-7 | Molecular Weight | 249.219 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 513.1±40.0 °C at 760 mmHg | |
| Molecular Formula | C12H11NO5 | Melting Point | 157-159ºC | |
| MSDS | Chinese USA | Flash Point | 264.1±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (2S)-4-(1,3-dioxoisoindol-2-yl)-2-hydroxybutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 513.1±40.0 °C at 760 mmHg |
| Melting Point | 157-159ºC |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.219 |
| Flash Point | 264.1±27.3 °C |
| Exact Mass | 249.063721 |
| PSA | 94.91000 |
| LogP | 1.17 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | YWDXODQRCDEZLN-VIFPVBQESA-N |
| SMILES | O=C(O)C(O)CCN1C(=O)c2ccccc2C1=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2925190090 |
|
~%
(2S)-4-(1,3-Dio... CAS#:48172-10-7 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 19, # 14 p. 3919 - 3923 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (S)-4-(1,3-Dioxoisoindolin-2-yl)-2-hydroxybutanoic acid |
| (2S)-4-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)-2-hydroxybutanoic acid |
| MFCD01457304 |
| 2H-Isoindole-2-butanoic acid, 1,3-dihydro-α-hydroxy-1,3-dioxo-, (αS)- |
| (S)-(+)-α-Hydroxy-1,3-dioxo-2-isoindolinebutyric acid |
| (2S)-4-(1,3-Dioxoisoindolin-2-yl)-2-hydroxybutanoic acid |