4-(5-nitrofuran-2-yl)morpholine
4-(5-nitrofuran-2-yl)morpholine structure
|
Common Name | 4-(5-nitrofuran-2-yl)morpholine | ||
|---|---|---|---|---|
| CAS Number | 4818-48-8 | Molecular Weight | 198.17600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(5-nitrofuran-2-yl)morpholine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H10N2O4 |
|---|---|
| Molecular Weight | 198.17600 |
| Exact Mass | 198.06400 |
| PSA | 71.43000 |
| LogP | 1.61260 |
| InChIKey | CKWVBMYVQJWULV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N2CCOCC2)o1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~99%
4-(5-nitrofuran... CAS#:4818-48-8 |
| Literature: Padwa, Albert; Dimitroff, Martin; Waterson, Alex G.; Wu, Tianhua Journal of Organic Chemistry, 1997 , vol. 62, # 12 p. 4088 - 4096 |
|
~44%
4-(5-nitrofuran... CAS#:4818-48-8 |
| Literature: Nguyen, Son T.; Ding, Xiaoyuan; Peet, Norton P. Synthesis (Germany), 2013 , vol. 45, # 13 art. no. SS-2012-C0967-OP, p. 1904 - 1908 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Nitro-5-morpholino-furan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-(5-nitrofuran-2-yl)morpholine? |
| A: Molecular weight of 4-(5-nitrofuran-2-yl)morpholine is 198.17600. |
| Q: What is the Chinese name of 4818-48-8? |
| A: Chinese name of 4818-48-8 is 4818-48-8. |
| Q: What are the upstream materials of 4-(5-nitrofuran-2-yl)morpholine? |
| A: Related upstream materials(CAS) of 4-(5-nitrofuran-2-yl)morpholine: 110-91-8;826-03-9;823-73-4. |
| Q: What is the molecular formula of 4-(5-nitrofuran-2-yl)morpholine? |
| A: Molecular formula of 4-(5-nitrofuran-2-yl)morpholine is C8H10N2O4. |
| Q: What is the LogP of 4-(5-nitrofuran-2-yl)morpholine? |
| A: LogP of 4-(5-nitrofuran-2-yl)morpholine is 1.61260. |
| Q: What is the polar surface area (PSA) of 4-(5-nitrofuran-2-yl)morpholine? |
| A: Polar surface area (PSA) of 4-(5-nitrofuran-2-yl)morpholine is 71.43000. |
| Q: What is the English name of 4-(5-nitrofuran-2-yl)morpholine? |
| A: The English name of 4-(5-nitrofuran-2-yl)morpholine is 4-(5-nitrofuran-2-yl)morpholine. |
| Q: What is the InChIKey of 4-(5-nitrofuran-2-yl)morpholine? |
| A: InChIKey of 4-(5-nitrofuran-2-yl)morpholine is CKWVBMYVQJWULV-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-(5-nitrofuran-2-yl)morpholine? |
| A: CAS number of 4-(5-nitrofuran-2-yl)morpholine is 4818-48-8. |
| Q: What English synonyms does 4-(5-nitrofuran-2-yl)morpholine have? |
| A: English synonyms of 4-(5-nitrofuran-2-yl)morpholine: 2-Nitro-5-morpholino-furan. |