diphenic acid structure
|
Common Name | diphenic acid | ||
|---|---|---|---|---|
| CAS Number | 482-05-3 | Molecular Weight | 242.227 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 422.8±20.0 °C at 760 mmHg | |
| Molecular Formula | C14H10O4 | Melting Point | 227-229 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 223.7±18.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | diphenic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 422.8±20.0 °C at 760 mmHg |
| Melting Point | 227-229 °C(lit.) |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.227 |
| Flash Point | 223.7±18.3 °C |
| Exact Mass | 242.057907 |
| PSA | 74.60000 |
| LogP | 2.02 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | GWZCCUDJHOGOSO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1-c1ccccc1C(=O)O |
| Water Solubility | insoluble (20 ºC) |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39-S37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29173980 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
[Effect of biphenyl dicarboxylate on abnormal laboratory findings in patients with chronic hepatitis and liver cirrhosis].
Zhong Xi Yi Jie He Za Zhi 3(3) , 163-4, (1983)
|
|
|
[The QSAR of diphenic acids in increasing macrophage phagocytosis].
Hua Xi Yi Ke Da Xue Xue Bao 17(3) , 224-7, (1986)
|
|
|
Oxidative degradation of phenanthrene by the ligninolytic fungus Phanerochaete chrysosporium.
Appl. Environ. Microbiol. 58(6) , 1832-8, (1992) The ligninolytic fungus Phanerochaete chrysosporium oxidized phenanthrene and phenanthrene-9,10-quinone (PQ) at their C-9 and C-10 positions to give a ring-fission product, 2,2'-diphenic acid (DPA), w... |
| BIPHENIC ACID |
| O,O'-DIPHENIC ACID |
| biphenyl-2,2′-dicarboxylic acid |
| diphenic acid |
| Diphenic |
| EINECS 207-576-4 |
| 2,2'-Biphenyldicarboxylic acid |
| 2,2'-DIPHENIC ACID |
| 2,2-United acid |
| 2,2-Bibenzoic Acid |
| O-DIPHENIC ACID |
| 2,2'-Diphenyldicarboxylic acid |
| biphenyl-2,2'-dicarboxylic acid |
| 2,2'-Bibenzoic Acid |
| 2,2Diphenit acid |
| [1,1'-Biphenyl]-2,2'-dicarboxylic acid |
| 2,2'-Dicarboxybiphenyl |
| MFCD00002464 |