Raupine structure
|
Common Name | Raupine | ||
|---|---|---|---|---|
| CAS Number | 482-68-8 | Molecular Weight | 310.39 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 524.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H22N2O2 | Melting Point | 320°C | |
| MSDS | N/A | Flash Point | 271.1±30.1 °C | |
Use of RaupineSarpagine is an alkaloid that can be isolated from Colombian Rauwolfia hirsufa[1]. |
| Name | sarpagine |
|---|---|
| Synonym | More Synonyms |
| Description | Sarpagine is an alkaloid that can be isolated from Colombian Rauwolfia hirsufa[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 524.6±50.0 °C at 760 mmHg |
| Melting Point | 320°C |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.39 |
| Flash Point | 271.1±30.1 °C |
| Exact Mass | 310.168121 |
| PSA | 59.49000 |
| LogP | 1.57 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.735 |
| InChIKey | VTVQHYQGTTVKDE-VWFUFAFFSA-N |
| SMILES | CC=C1CN2C3CC1C(CO)C2Cc1c3[nH]c2ccc(O)cc12 |
| Hazard Codes | Xi |
|---|---|
| RIDADR | UN 1544 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| (19E)-Sarpagan-10,17-diol |
| Sarpagan-10,17-diol |
| Sarpagane-10,17-diol |
| Raupine |
| 10,17-sarpagandiol |