(-)-Aricine structure
|
Common Name | (-)-Aricine | ||
|---|---|---|---|---|
| CAS Number | 482-91-7 | Molecular Weight | 382.453 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 553.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H26N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.3±30.1 °C | |
Use of (-)-AricineAricine ((-)-Aricine), an indole alkaloid, displays larvicidal activity[1]. |
| Name | Aricine |
|---|---|
| Synonym | More Synonyms |
| Description | Aricine ((-)-Aricine), an indole alkaloid, displays larvicidal activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 553.0±50.0 °C at 760 mmHg |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.453 |
| Flash Point | 288.3±30.1 °C |
| Exact Mass | 382.189270 |
| PSA | 63.79000 |
| LogP | 2.74 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | DTDADHMBRZKXSC-GKASHWOUSA-N |
| SMILES | COC(=O)C1=COC(C)C2CN3CCc4c([nH]c5ccc(OC)cc45)C3CC12 |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| Quinovatine |
| Heterophylline (VAN) |
| Methyl (19α,20α)-11-methoxy-19-methyl-16,17-didehydro-18-oxayohimban-16-carboxylate |
| Heterophylline |
| Aricine (8CI) |
| Oxayohimban-16-carboxylic acid, 16,17-didehydro-11-methoxy-19-methyl-, methyl ester, (19α,20α)- |
| (-)-Aricine |