bromophos-ethyl structure
|
Common Name | bromophos-ethyl | ||
|---|---|---|---|---|
| CAS Number | 4824-78-6 | Molecular Weight | 394.049 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 388.8±52.0 °C at 760 mmHg | |
| Molecular Formula | C10H12BrCl2O3PS | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 188.9±30.7 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | bromophos-ethyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 388.8±52.0 °C at 760 mmHg |
| Molecular Formula | C10H12BrCl2O3PS |
| Molecular Weight | 394.049 |
| Flash Point | 188.9±30.7 °C |
| Exact Mass | 391.880524 |
| PSA | 69.59000 |
| LogP | 6.13 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | KWGUFOITWDSNQY-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)Oc1cc(Cl)c(Br)cc1Cl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H312-H410 |
| Precautionary Statements | P273-P280-P301 + P310-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T,N |
| Risk Phrases | 21-25-50/53 |
| Safety Phrases | 28-36/37-45-60-61 |
| RIDADR | 3018 |
| WGK Germany | 3 |
| RTECS | TE7000000 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
|
In vitro sequestration of two organophosphorus homologs by the rat liver.
Chem. Biol. Interact. 119-120 , 277-82, (1999) Bromophos (Bp) and ethylbromophos (EBp) are two structurally homologous organophosphorus insecticides (OP) which show a 24-fold difference in their toxicity to the laboratory rat (LD50--2215 and 91 mg... |
|
|
Mutagenic properties of methyl- and ethylbromophos in mammals.
Bull. Environ. Contam. Toxicol. 32(3) , 269-73, (1984)
|
|
|
Neurotoxicity and pattern of acetylcholinesterase inhibition in the brain regions of rat by bromophos and ethylbromophos.
Fundam. Appl. Toxicol. 32(1) , 23-30, (1996) Bromophos (Bp) and ethylbromophos (EBp) are two structurally homologous organophosphorus (OP) insecticides which show wide differences in their toxicity as well as neurotoxic symptoms in the laborator... |
| bromophos-ethyl |
| Ethyl bromophos |
| O-(4-Bromo-2,5-dichlorophenyl) O,O-diethyl phosphorothioate |
| MFCD00055262 |
| O-4-bromo-2,5-dichlorophenyl O,O-diethyl phosphorothioate |
| EINECS 225-399-0 |
| (4-bromo-2,5-dichlorophenoxy)-diethoxy-sulfanylidene-λ<sup>5</sup>-phosphane |
| 4-Bromo-2,5-dichlorophenol O-ester with O,O-diethyl phosphorothioate |
| Phosphorothioic acid, O-(4-bromo-2,5-dichlorophenyl) O,O-diethyl ester |